CONTACT US
 

 TEL: 86-0512-63009836
 FAX: 86-0512-63006936
 QQ: 1933702730 1827891490

 
      PRODUCT SEARCH
    Chemicals Search
 

 
    Popular Products



      Recommended Products
 



 
FMOC-D-TIC(OH)-OH178432-50-3  



 
methyl 4-methyl-1-naphthoate35615-98-6  



 
3-Bromo-N-(3,5-dichloro-phenyl)-benzenesulfonamide  
Product Information
Compound: 5-chloroquinoline-3-carboxylic acid

Cas NO.: 1416439-55-8
Catalog NO.: SC-68890
Leadtime:
Purity: 95

MF:C10H6ClNO2
MW: 207.61
MDL: MFCD22690552

 
Email  
Name      *
Company     
Country     
Quantity      *
Remark